About 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine
4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine (PubChem CID 89030466) has the molecular formula C10H12FNO
and a molecular weight of 181.21 g/mol. Its IUPAC name is 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 89030466 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine |
| SMILES | CCN1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C10H12FNO/c1-2-12-5-6-13-10-4-3-8(11)7-9(10)12/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | RXNOWYZBBOHAIQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine (CID 89030466) is 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine is CCN1CCOc2ccc(F)cc21.
What is the InChIKey of 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine?
The InChIKey is RXNOWYZBBOHAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO/c1-2-12-5-6-13-10-4-3-8(11)7-9(10)12/h3-4,7H,2,5-6H2,1H3.
What are the key properties of 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine?
4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine has a molecular weight of 181.21 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-fluoro-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 89030466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).