C16H17BN2O4S — CID 89030492
N-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]benzenesulfonamide (PubChem CID 89030492) has the molecular formula C16H17BN2O4S and a molecular weight of 344.20 g/mol. Its IUPAC name is N-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]benzenesulfonamide.
| Compound Name | N-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 89030492 |
| Molecular Formula | C16H17BN2O4S |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]benzenesulfonamide |
| SMILES | C=C1OB(c2cncc(NS(=O)(=O)c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C16H17BN2O4S/c1-12-16(2,3)23-17(22-12)13-9-14(11-18-10-13)19-24(20,21)15-7-5-4-6-8-15/h4-11,19H,1H2,2-3H3 |
| InChIKey | PGWGNORYSHHJPD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|