C27H27N3O5 — CID 89030715
2-[[[4-[4-[(5R)-5-(acetamidomethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]phenyl]methylamino]oxymethyl]benzoic acid (PubChem CID 89030715) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-[[[4-[4-[(5R)-5-(acetamidomethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]phenyl]methylamino]oxymethyl]benzoic acid.
| Compound Name | 2-[[[4-[4-[(5R)-5-(acetamidomethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]phenyl]methylamino]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 89030715 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 2-[[[4-[4-[(5R)-5-(acetamidomethyl)-4,5-dihydro-1,2-oxazol-3-yl]phenyl]phenyl]methylamino]oxymethyl]benzoic acid |
| SMILES | CC(=O)NC[C@H]1CC(c2ccc(-c3ccc(CNOCc4ccccc4C(=O)O)cc3)cc2)=NO1 |
| InChI | InChI=1S/C27H27N3O5/c1-18(31)28-16-24-14-26(30-35-24)22-12-10-21(11-13-22)20-8-6-19(7-9-20)15-29-34-17-23-4-2-3-5-25(23)27(32)33/h2-13,24,29H,14-17H2,1H3,(H,28,31)(H,32,33)/t24-/m1/s1 |
| InChIKey | OFVIZKUFWXFMCG-XMMPIXPASA-N |
| XLogP | 3.90 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|