About 2-ethyl-2,3,5-trimethyl-3H-furan
2-ethyl-2,3,5-trimethyl-3H-furan (PubChem CID 89030719) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-ethyl-2,3,5-trimethyl-3H-furan.
Molecular Properties
| Compound Name | 2-ethyl-2,3,5-trimethyl-3H-furan |
| PubChem CID | 89030719 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2-ethyl-2,3,5-trimethyl-3H-furan |
| SMILES | CCC1(C)OC(C)=CC1C |
| InChI | InChI=1S/C9H16O/c1-5-9(4)7(2)6-8(3)10-9/h6-7H,5H2,1-4H3 |
| InChIKey | MJPSTBXTSPZJFU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-2,3,5-trimethyl-3H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,3,5-trimethyl-3H-furan?
The IUPAC name of 2-ethyl-2,3,5-trimethyl-3H-furan (CID 89030719) is 2-ethyl-2,3,5-trimethyl-3H-furan.
What is the SMILES notation for 2-ethyl-2,3,5-trimethyl-3H-furan?
The canonical SMILES for 2-ethyl-2,3,5-trimethyl-3H-furan is CCC1(C)OC(C)=CC1C.
What is the InChIKey of 2-ethyl-2,3,5-trimethyl-3H-furan?
The InChIKey is MJPSTBXTSPZJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-5-9(4)7(2)6-8(3)10-9/h6-7H,5H2,1-4H3.
What are the key properties of 2-ethyl-2,3,5-trimethyl-3H-furan?
2-ethyl-2,3,5-trimethyl-3H-furan has a molecular weight of 140.23 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,3,5-trimethyl-3H-furan is sourced from PubChem (CID 89030719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).