About 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine
1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine (PubChem CID 89030767) has the molecular formula C18H25ClN2S
and a molecular weight of 336.93 g/mol. Its IUPAC name is 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine.
Molecular Properties
| Compound Name | 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine |
| PubChem CID | 89030767 |
| Molecular Formula | C18H25ClN2S |
| Molecular Weight | 336.93 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine |
| SMILES | ClC1CC=C(CN2CCN(CCCc3ccccc3)CC2)S1 |
| InChI | InChI=1S/C18H25ClN2S/c19-18-9-8-17(22-18)15-21-13-11-20(12-14-21)10-4-7-16-5-2-1-3-6-16/h1-3,5-6,8,18H,4,7,9-15H2 |
| InChIKey | MEICHVNNFLIJJM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.93 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine?
The IUPAC name of 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine (CID 89030767) is 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine.
What is the SMILES notation for 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine?
The canonical SMILES for 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine is ClC1CC=C(CN2CCN(CCCc3ccccc3)CC2)S1.
What is the InChIKey of 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine?
The InChIKey is MEICHVNNFLIJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN2S/c19-18-9-8-17(22-18)15-21-13-11-20(12-14-21)10-4-7-16-5-2-1-3-6-16/h1-3,5-6,8,18H,4,7,9-15H2.
What are the key properties of 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine?
1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine has a molecular weight of 336.93 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-2,3-dihydrothiophen-5-yl)methyl]-4-(3-phenylpropyl)piperazine is sourced from PubChem (CID 89030767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).