C11H15FO — CID 89030803
(2E,4Z)-3-[(1E,3E)-4-fluoropenta-1,3-dienoxy]hexa-2,4-diene (PubChem CID 89030803) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is (2E,4Z)-3-[(1E,3E)-4-fluoropenta-1,3-dienoxy]hexa-2,4-diene.
| Compound Name | (2E,4Z)-3-[(1E,3E)-4-fluoropenta-1,3-dienoxy]hexa-2,4-diene |
|---|---|
| PubChem CID | 89030803 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (2E,4Z)-3-[(1E,3E)-4-fluoropenta-1,3-dienoxy]hexa-2,4-diene |
| SMILES | C/C=C\C(=C/C)O/C=C/C=C(\C)F |
| InChI | InChI=1S/C11H15FO/c1-4-7-11(5-2)13-9-6-8-10(3)12/h4-9H,1-3H3/b7-4-,9-6+,10-8+,11-5+ |
| InChIKey | NAKSLLILGKXZLC-RSDHXQPYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|