About 4-nitrosonaphthalen-2-ol
4-nitrosonaphthalen-2-ol (PubChem CID 89031737) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is 4-nitrosonaphthalen-2-ol.
Molecular Properties
| Compound Name | 4-nitrosonaphthalen-2-ol |
| PubChem CID | 89031737 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 4-nitrosonaphthalen-2-ol |
| SMILES | O=Nc1cc(O)cc2ccccc12 |
| InChI | InChI=1S/C10H7NO2/c12-8-5-7-3-1-2-4-9(7)10(6-8)11-13/h1-6,12H |
| InChIKey | GXFVGCFJMRUENG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-nitrosonaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrosonaphthalen-2-ol?
The IUPAC name of 4-nitrosonaphthalen-2-ol (CID 89031737) is 4-nitrosonaphthalen-2-ol.
What is the SMILES notation for 4-nitrosonaphthalen-2-ol?
The canonical SMILES for 4-nitrosonaphthalen-2-ol is O=Nc1cc(O)cc2ccccc12.
What is the InChIKey of 4-nitrosonaphthalen-2-ol?
The InChIKey is GXFVGCFJMRUENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-8-5-7-3-1-2-4-9(7)10(6-8)11-13/h1-6,12H.
What are the key properties of 4-nitrosonaphthalen-2-ol?
4-nitrosonaphthalen-2-ol has a molecular weight of 173.17 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrosonaphthalen-2-ol is sourced from PubChem (CID 89031737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).