C25H26ClN3O6 — CID 89031788
methyl 4-[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-4-carboxylate (PubChem CID 89031788) has the molecular formula C25H26ClN3O6 and a molecular weight of 499.95 g/mol. Its IUPAC name is methyl 4-[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 4-[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 89031788 |
| Molecular Formula | C25H26ClN3O6 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | methyl 4-[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,3-oxazol-2-yl]-1-[hydroxy(methyl)carbamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2nc(-c3ccc(Cl)cc3)c(-c3ccc(OC)cc3)o2)CCN(C(=O)N(C)O)CC1 |
| InChI | InChI=1S/C25H26ClN3O6/c1-28(32)24(31)29-14-12-25(13-15-29,23(30)34-3)22-27-20(16-4-8-18(26)9-5-16)21(35-22)17-6-10-19(33-2)11-7-17/h4-11,32H,12-15H2,1-3H3 |
| InChIKey | ZWOCTNASWREJSE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|