About 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane
1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane (PubChem CID 89031910) has the molecular formula C19H40O2S
and a molecular weight of 332.59 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane |
| PubChem CID | 89031910 |
| Molecular Formula | C19H40O2S |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane |
| SMILES | CC(C)(C)CC(OC(C)(C)CCOC(C)(C)C)SC(C)(C)C |
| InChI | InChI=1S/C19H40O2S/c1-16(2,3)14-15(22-18(7,8)9)21-19(10,11)12-13-20-17(4,5)6/h15H,12-14H2,1-11H3 |
| InChIKey | OGYFGQZAFFBRQF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane?
The IUPAC name of 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane (CID 89031910) is 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane.
What is the SMILES notation for 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane?
The canonical SMILES for 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane is CC(C)(C)CC(OC(C)(C)CCOC(C)(C)C)SC(C)(C)C.
What is the InChIKey of 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane?
The InChIKey is OGYFGQZAFFBRQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O2S/c1-16(2,3)14-15(22-18(7,8)9)21-19(10,11)12-13-20-17(4,5)6/h15H,12-14H2,1-11H3.
What are the key properties of 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane?
1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane has a molecular weight of 332.59 g/mol, XLogP of 6.28, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyl-3,3-dimethyl-1-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxybutane is sourced from PubChem (CID 89031910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).