C11H16F6N2O5S2 — CID 89032141
1-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 89032141) has the molecular formula C11H16F6N2O5S2 and a molecular weight of 434.38 g/mol. Its IUPAC name is 1-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 89032141 |
| Molecular Formula | C11H16F6N2O5S2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 1-[4-(3-ethylsulfonyl-1,1,2,2,3,3-hexafluoropropyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | CCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C11H16F6N2O5S2/c1-3-25(21,22)10(14,15)9(12,13)11(16,17)26(23,24)19-6-4-18(5-7-19)8(2)20/h3-7H2,1-2H3 |
| InChIKey | JHXICSAZZNCXSQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|