C7H10F4N2O5S — CID 89032145
3-(2-acetamidoethylamino)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonic acid (PubChem CID 89032145) has the molecular formula C7H10F4N2O5S and a molecular weight of 310.23 g/mol. Its IUPAC name is 3-(2-acetamidoethylamino)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-(2-acetamidoethylamino)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 89032145 |
| Molecular Formula | C7H10F4N2O5S |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-(2-acetamidoethylamino)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonic acid |
| SMILES | CC(=O)NCCNC(=O)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C7H10F4N2O5S/c1-4(14)12-2-3-13-5(15)6(8,9)7(10,11)19(16,17)18/h2-3H2,1H3,(H,12,14)(H,13,15)(H,16,17,18) |
| InChIKey | FKDPLSAIMCDPAQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|