About 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol
2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol (PubChem CID 89032326) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol.
Molecular Properties
| Compound Name | 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol |
| PubChem CID | 89032326 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol |
| SMILES | Cc1cc(-n2nc3cc(CO)c(CO)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-11-5-14(19(2,3)4)18(25)17(6-11)22-20-15-7-12(9-23)13(10-24)8-16(15)21-22/h5-8,23-25H,9-10H2,1-4H3 |
| InChIKey | XIMCMMPEOWUAFN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol?
The IUPAC name of 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol (CID 89032326) is 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol.
What is the SMILES notation for 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol?
The canonical SMILES for 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol is Cc1cc(-n2nc3cc(CO)c(CO)cc3n2)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol?
The InChIKey is XIMCMMPEOWUAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3/c1-11-5-14(19(2,3)4)18(25)17(6-11)22-20-15-7-12(9-23)13(10-24)8-16(15)21-22/h5-8,23-25H,9-10H2,1-4H3.
What are the key properties of 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol?
2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol has a molecular weight of 341.41 g/mol, XLogP of 2.72, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-bis(hydroxymethyl)benzotriazol-2-yl]-6-tert-butyl-4-methylphenol is sourced from PubChem (CID 89032326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).