About 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole
4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole (PubChem CID 89032514) has the molecular formula C8H9FN4
and a molecular weight of 180.19 g/mol. Its IUPAC name is 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole.
Molecular Properties
| Compound Name | 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole |
| PubChem CID | 89032514 |
| Molecular Formula | C8H9FN4 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole |
| SMILES | Cc1c(F)c(-n2cccn2)nn1C |
| InChI | InChI=1S/C8H9FN4/c1-6-7(9)8(11-12(6)2)13-5-3-4-10-13/h3-5H,1-2H3 |
| InChIKey | RNESCUCANFIFIX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole?
The IUPAC name of 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole (CID 89032514) is 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole.
What is the SMILES notation for 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole?
The canonical SMILES for 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole is Cc1c(F)c(-n2cccn2)nn1C.
What is the InChIKey of 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole?
The InChIKey is RNESCUCANFIFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN4/c1-6-7(9)8(11-12(6)2)13-5-3-4-10-13/h3-5H,1-2H3.
What are the key properties of 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole?
4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole has a molecular weight of 180.19 g/mol, XLogP of 1.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,5-dimethyl-3-pyrazol-1-ylpyrazole is sourced from PubChem (CID 89032514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).