About 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole
5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole (PubChem CID 89032535) has the molecular formula C9H10FN3O
and a molecular weight of 195.20 g/mol. Its IUPAC name is 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole.
Analyze 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole?
The IUPAC name of 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole (CID 89032535) is 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole.
What is the SMILES notation for 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole?
The canonical SMILES for 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole is CCn1nc(-c2cnco2)c(F)c1C.
What is the InChIKey of 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole?
The InChIKey is FRCCEYBIMPTANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O/c1-3-13-6(2)8(10)9(12-13)7-4-11-5-14-7/h4-5H,3H2,1-2H3.
What are the key properties of 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole?
5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole has a molecular weight of 195.20 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethyl-4-fluoro-5-methylpyrazol-3-yl)-1,3-oxazole is sourced from PubChem (CID 89032535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).