C14H29NO — CID 89032970
4-(ethylamino)-9,9-dimethyldecan-3-one (PubChem CID 89032970) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 4-(ethylamino)-9,9-dimethyldecan-3-one.
| Compound Name | 4-(ethylamino)-9,9-dimethyldecan-3-one |
|---|---|
| PubChem CID | 89032970 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 4-(ethylamino)-9,9-dimethyldecan-3-one |
| SMILES | CCNC(CCCCC(C)(C)C)C(=O)CC |
| InChI | InChI=1S/C14H29NO/c1-6-13(16)12(15-7-2)10-8-9-11-14(3,4)5/h12,15H,6-11H2,1-5H3 |
| InChIKey | INDNCAUOUGFSAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|