About 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one
4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one (PubChem CID 89032995) has the molecular formula C22H19F2NO5
and a molecular weight of 415.39 g/mol. Its IUPAC name is 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one.
Molecular Properties
| Compound Name | 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one |
| PubChem CID | 89032995 |
| Molecular Formula | C22H19F2NO5 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one |
| SMILES | C=C(O)COc1ccc(-n2ccc(COc3ccc(F)cc3F)cc2=O)cc1OC |
| InChI | InChI=1S/C22H19F2NO5/c1-14(26)12-29-20-6-4-17(11-21(20)28-2)25-8-7-15(9-22(25)27)13-30-19-5-3-16(23)10-18(19)24/h3-11,26H,1,12-13H2,2H3 |
| InChIKey | WNBDIRYPWXJSDF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one?
The IUPAC name of 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one (CID 89032995) is 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one.
What is the SMILES notation for 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one?
The canonical SMILES for 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one is C=C(O)COc1ccc(-n2ccc(COc3ccc(F)cc3F)cc2=O)cc1OC.
What is the InChIKey of 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one?
The InChIKey is WNBDIRYPWXJSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2NO5/c1-14(26)12-29-20-6-4-17(11-21(20)28-2)25-8-7-15(9-22(25)27)13-30-19-5-3-16(23)10-18(19)24/h3-11,26H,1,12-13H2,2H3.
What are the key properties of 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one?
4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one has a molecular weight of 415.39 g/mol, XLogP of 4.15, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-difluorophenoxy)methyl]-1-[4-(2-hydroxyprop-2-enoxy)-3-methoxyphenyl]pyridin-2-one is sourced from PubChem (CID 89032995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).