C7H6ClNS — CID 89033152
7-chloro-2,3-dihydrothieno[3,2-b]pyridine (PubChem CID 89033152) has the molecular formula C7H6ClNS and a molecular weight of 171.65 g/mol. Its IUPAC name is 7-chloro-2,3-dihydrothieno[3,2-b]pyridine.
| Compound Name | 7-chloro-2,3-dihydrothieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 89033152 |
| Molecular Formula | C7H6ClNS |
| Molecular Weight | 171.65 g/mol |
| Exact Mass | 170.99 |
| IUPAC Name | 7-chloro-2,3-dihydrothieno[3,2-b]pyridine |
| SMILES | Clc1ccnc2c1SCC2 |
| InChI | InChI=1S/C7H6ClNS/c8-5-1-3-9-6-2-4-10-7(5)6/h1,3H,2,4H2 |
| InChIKey | JHPAZYTWFYDDSN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |