About CID 89033318
CID 89033318 (PubChem CID 89033318) has the molecular formula C36H38BNO10
and a molecular weight of 655.51 g/mol.
Molecular Properties
| Compound Name | CID 89033318 |
| PubChem CID | 89033318 |
| Molecular Formula | C36H38BNO10 |
| Molecular Weight | 655.51 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C(=O)O[C@H]2CC3C(C)(COC(C)=O)[C@@H](OC(C)=O)CC[C@]3(C)C3C(O)c4c(cc(-c5cccnc5)oc4=O)O[C@@]32C)c1 |
| InChI | InChI=1S/C36H38BNO10/c1-19(39)44-18-35(4)26-16-28(47-32(42)21-8-6-10-23(37)14-21)36(5)31(34(26,3)12-11-27(35)45-20(2)40)30(41)29-25(48-36)15-24(46-33(29)43)22-9-7-13-38-17-22/h6-10,13-15,17,26-28,30-31,41H,11-12,16,18H2,1-5H3/t26?,27-,28-,30?,31?,34-,35?,36+/m0/s1 |
| InChIKey | ZAUNXJYGIQBTBT-RRLBYADUSA-N |
| XLogP | 3.84 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89033318 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89033318?
The IUPAC name of CID 89033318 (CID 89033318) is not available.
What is the SMILES notation for CID 89033318?
The canonical SMILES for CID 89033318 is [B]c1cccc(C(=O)O[C@H]2CC3C(C)(COC(C)=O)[C@@H](OC(C)=O)CC[C@]3(C)C3C(O)c4c(cc(-c5cccnc5)oc4=O)O[C@@]32C)c1.
What is the InChIKey of CID 89033318?
The InChIKey is ZAUNXJYGIQBTBT-RRLBYADUSA-N. The full InChI is InChI=1S/C36H38BNO10/c1-19(39)44-18-35(4)26-16-28(47-32(42)21-8-6-10-23(37)14-21)36(5)31(34(26,3)12-11-27(35)45-20(2)40)30(41)29-25(48-36)15-24(46-33(29)43)22-9-7-13-38-17-22/h6-10,13-15,17,26-28,30-31,41H,11-12,16,18H2,1-5H3/t26?,27-,28-,30?,31?,34-,35?,36+/m0/s1.
What are the key properties of CID 89033318?
CID 89033318 has a molecular weight of 655.51 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89033318 is sourced from PubChem (CID 89033318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).