About (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one
(5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one (PubChem CID 89034026) has the molecular formula C5H7NO4
and a molecular weight of 145.11 g/mol. Its IUPAC name is (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one.
Molecular Properties
| Compound Name | (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one |
| PubChem CID | 89034026 |
| Molecular Formula | C5H7NO4 |
| Molecular Weight | 145.11 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one |
| SMILES | C[C@@]1(N)OC(=O)C(O)=C1O |
| InChI | InChI=1S/C5H7NO4/c1-5(6)3(8)2(7)4(9)10-5/h7-8H,6H2,1H3/t5-/m1/s1 |
| InChIKey | DYRYJTPQPCXOJS-RXMQYKEDSA-N |
| XLogP | -0.45 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.11 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one?
The IUPAC name of (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one (CID 89034026) is (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one.
What is the SMILES notation for (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one?
The canonical SMILES for (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one is C[C@@]1(N)OC(=O)C(O)=C1O.
What is the InChIKey of (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one?
The InChIKey is DYRYJTPQPCXOJS-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H7NO4/c1-5(6)3(8)2(7)4(9)10-5/h7-8H,6H2,1H3/t5-/m1/s1.
What are the key properties of (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one?
(5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one has a molecular weight of 145.11 g/mol, XLogP of -0.45, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-amino-3,4-dihydroxy-5-methylfuran-2-one is sourced from PubChem (CID 89034026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).