C9H15N — CID 89034156
(1Z,3Z)-2-ethyl-5-methylhexa-1,3,5-trien-1-amine (PubChem CID 89034156) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (1Z,3Z)-2-ethyl-5-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-2-ethyl-5-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89034156 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (1Z,3Z)-2-ethyl-5-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(C)/C=C\C(=C/N)CC |
| InChI | InChI=1S/C9H15N/c1-4-9(7-10)6-5-8(2)3/h5-7H,2,4,10H2,1,3H3/b6-5-,9-7- |
| InChIKey | GORZTDRCWJFPIN-LZWBOMALSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|