About 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one
2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one (PubChem CID 89034163) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one |
| PubChem CID | 89034163 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one |
| SMILES | CC(C)c1cc2c[nH]c(=O)cc2[nH]1 |
| InChI | InChI=1S/C10H12N2O/c1-6(2)8-3-7-5-11-10(13)4-9(7)12-8/h3-6,12H,1-2H3,(H,11,13) |
| InChIKey | GUGQMKQDTRUNNZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one?
The IUPAC name of 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one (CID 89034163) is 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one.
What is the SMILES notation for 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one?
The canonical SMILES for 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one is CC(C)c1cc2c[nH]c(=O)cc2[nH]1.
What is the InChIKey of 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one?
The InChIKey is GUGQMKQDTRUNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-6(2)8-3-7-5-11-10(13)4-9(7)12-8/h3-6,12H,1-2H3,(H,11,13).
What are the key properties of 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one?
2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one has a molecular weight of 176.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,5-dihydropyrrolo[3,2-c]pyridin-6-one is sourced from PubChem (CID 89034163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).