About N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine
N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine (PubChem CID 89034221) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine |
| PubChem CID | 89034221 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine |
| SMILES | CNCCc1nc(C(C)C)co1 |
| InChI | InChI=1S/C9H16N2O/c1-7(2)8-6-12-9(11-8)4-5-10-3/h6-7,10H,4-5H2,1-3H3 |
| InChIKey | QJCNWUWQMZUNRE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine?
The IUPAC name of N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine (CID 89034221) is N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine.
What is the SMILES notation for N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine?
The canonical SMILES for N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine is CNCCc1nc(C(C)C)co1.
What is the InChIKey of N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine?
The InChIKey is QJCNWUWQMZUNRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-7(2)8-6-12-9(11-8)4-5-10-3/h6-7,10H,4-5H2,1-3H3.
What are the key properties of N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine?
N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine has a molecular weight of 168.24 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(4-propan-2-yl-1,3-oxazol-2-yl)ethanamine is sourced from PubChem (CID 89034221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).