C24H25ClF3N3O5 — CID 89034533
methyl (2E)-2-[[[amino-[3-chloro-4-[(2S,3S)-3-(1,5-dimethyl-6-oxo-3-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]methylidene]amino]methylidene]but-3-enoate (PubChem CID 89034533) has the molecular formula C24H25ClF3N3O5 and a molecular weight of 527.93 g/mol. Its IUPAC name is methyl (2E)-2-[[[amino-[3-chloro-4-[(2S,3S)-3-(1,5-dimethyl-6-oxo-3-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]methylidene]amino]methylidene]but-3-enoate.
| Compound Name | methyl (2E)-2-[[[amino-[3-chloro-4-[(2S,3S)-3-(1,5-dimethyl-6-oxo-3-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]methylidene]amino]methylidene]but-3-enoate |
|---|---|
| PubChem CID | 89034533 |
| Molecular Formula | C24H25ClF3N3O5 |
| Molecular Weight | 527.93 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | methyl (2E)-2-[[[amino-[3-chloro-4-[(2S,3S)-3-(1,5-dimethyl-6-oxo-3-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]methylidene]amino]methylidene]but-3-enoate |
| SMILES | C=C/C(=C\N=C(/N)Oc1ccc([C@H](C)[C@](O)(c2cc(C)c(=O)n(C)c2)C(F)(F)F)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C24H25ClF3N3O5/c1-6-15(21(33)35-5)11-30-22(29)36-17-7-8-18(19(25)10-17)14(3)23(34,24(26,27)28)16-9-13(2)20(32)31(4)12-16/h6-12,14,34H,1H2,2-5H3,(H2,29,30)/b15-11+/t14-,23-/m0/s1 |
| InChIKey | AWAVWXIFMBYCGI-MBLXVKSCSA-N |
| XLogP | 3.84 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.93 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|