C20H18F3N7O2S — CID 89034753
1-(5-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazol-3-yl]ethyl]urea (PubChem CID 89034753) has the molecular formula C20H18F3N7O2S and a molecular weight of 477.47 g/mol. Its IUPAC name is 1-(5-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazol-3-yl]ethyl]urea.
| Compound Name | 1-(5-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazol-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 89034753 |
| Molecular Formula | C20H18F3N7O2S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-(5-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-[2-[5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazol-3-yl]ethyl]urea |
| SMILES | CC(CC(F)(F)F)c1nc(CCNC(=O)Nc2nc3ccc(-c4cccnc4)nc3s2)no1 |
| InChI | InChI=1S/C20H18F3N7O2S/c1-11(9-20(21,22)23)16-28-15(30-32-16)6-8-25-18(31)29-19-27-14-5-4-13(26-17(14)33-19)12-3-2-7-24-10-12/h2-5,7,10-11H,6,8-9H2,1H3,(H2,25,27,29,31) |
| InChIKey | FSAQJHSZRXOEEX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |