C15H25N3 — CID 89034874
(1Z,3E)-3-(3,9-diazaspiro[5.5]undecan-3-yl)hexa-1,3,5-trien-1-amine (PubChem CID 89034874) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (1Z,3E)-3-(3,9-diazaspiro[5.5]undecan-3-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-(3,9-diazaspiro[5.5]undecan-3-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89034874 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (1Z,3E)-3-(3,9-diazaspiro[5.5]undecan-3-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)N1CCC2(CCNCC2)CC1 |
| InChI | InChI=1S/C15H25N3/c1-2-3-14(4-9-16)18-12-7-15(8-13-18)5-10-17-11-6-15/h2-4,9,17H,1,5-8,10-13,16H2/b9-4-,14-3+ |
| InChIKey | LQTQHPIGPCHHHT-IVCCSWCPSA-N |
| XLogP | 1.99 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|