C11H18N2O — CID 89034933
(1Z,3E)-3-piperidin-4-yloxyhexa-1,3,5-trien-1-amine (PubChem CID 89034933) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (1Z,3E)-3-piperidin-4-yloxyhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-piperidin-4-yloxyhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89034933 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (1Z,3E)-3-piperidin-4-yloxyhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)OC1CCNCC1 |
| InChI | InChI=1S/C11H18N2O/c1-2-3-10(4-7-12)14-11-5-8-13-9-6-11/h2-4,7,11,13H,1,5-6,8-9,12H2/b7-4-,10-3+ |
| InChIKey | FUMNFGCOIHTOOG-PZPRPFQRSA-N |
| XLogP | 1.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|