About (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine
(Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine (PubChem CID 89035120) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine |
| PubChem CID | 89035120 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine |
| SMILES | C=C(C)/C=C\C=N/N |
| InChI | InChI=1S/C6H10N2/c1-6(2)4-3-5-8-7/h3-5H,1,7H2,2H3/b4-3-,8-5- |
| InChIKey | VJRYJQDJNOTPEB-UBNNFMAXSA-N |
| XLogP | 1.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine?
The IUPAC name of (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine (CID 89035120) is (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine.
What is the SMILES notation for (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine?
The canonical SMILES for (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine is C=C(C)/C=C\C=N/N.
What is the InChIKey of (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine?
The InChIKey is VJRYJQDJNOTPEB-UBNNFMAXSA-N. The full InChI is InChI=1S/C6H10N2/c1-6(2)4-3-5-8-7/h3-5H,1,7H2,2H3/b4-3-,8-5-.
What are the key properties of (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine?
(Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine has a molecular weight of 110.16 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[(2Z)-4-methylpenta-2,4-dienylidene]hydrazine is sourced from PubChem (CID 89035120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).