C13H6F14 — CID 89035185
1,3-bis(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylbenzene (PubChem CID 89035185) has the molecular formula C13H6F14 and a molecular weight of 428.16 g/mol. Its IUPAC name is 1,3-bis(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylbenzene.
| Compound Name | 1,3-bis(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylbenzene |
|---|---|
| PubChem CID | 89035185 |
| Molecular Formula | C13H6F14 |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 1,3-bis(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylbenzene |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)F)cc(C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H6F14/c1-5-2-6(8(14,15)10(18,19)12(22,23)24)4-7(3-5)9(16,17)11(20,21)13(25,26)27/h2-4H,1H3 |
| InChIKey | JNWSAEIMOILHNI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|