About 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine
2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine (PubChem CID 89035224) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine |
| PubChem CID | 89035224 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine |
| SMILES | CNCCC1=C(F)CCC=C1 |
| InChI | InChI=1S/C9H14FN/c1-11-7-6-8-4-2-3-5-9(8)10/h2,4,11H,3,5-7H2,1H3 |
| InChIKey | AHQJJKGOOHZDHR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
The IUPAC name of 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine (CID 89035224) is 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine.
What is the SMILES notation for 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
The canonical SMILES for 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine is CNCCC1=C(F)CCC=C1.
What is the InChIKey of 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
The InChIKey is AHQJJKGOOHZDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-11-7-6-8-4-2-3-5-9(8)10/h2,4,11H,3,5-7H2,1H3.
What are the key properties of 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine?
2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine has a molecular weight of 155.22 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorocyclohexa-1,5-dien-1-yl)-N-methylethanamine is sourced from PubChem (CID 89035224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).