About CID 89035429
CID 89035429 (PubChem CID 89035429) has the molecular formula C10H14BF3N2
and a molecular weight of 230.04 g/mol.
Molecular Properties
| Compound Name | CID 89035429 |
| PubChem CID | 89035429 |
| Molecular Formula | C10H14BF3N2 |
| Molecular Weight | 230.04 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | — |
| SMILES | [B]Cc1c(CCCC)nc(C(F)(F)F)n1C |
| InChI | InChI=1S/C10H14BF3N2/c1-3-4-5-7-8(6-11)16(2)9(15-7)10(12,13)14/h3-6H2,1-2H3 |
| InChIKey | JFUYZFFTJAXHGR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89035429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89035429?
The IUPAC name of CID 89035429 (CID 89035429) is not available.
What is the SMILES notation for CID 89035429?
The canonical SMILES for CID 89035429 is [B]Cc1c(CCCC)nc(C(F)(F)F)n1C.
What is the InChIKey of CID 89035429?
The InChIKey is JFUYZFFTJAXHGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BF3N2/c1-3-4-5-7-8(6-11)16(2)9(15-7)10(12,13)14/h3-6H2,1-2H3.
What are the key properties of CID 89035429?
CID 89035429 has a molecular weight of 230.04 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89035429 is sourced from PubChem (CID 89035429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).