About 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one
4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one (PubChem CID 89035499) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one.
Molecular Properties
| Compound Name | 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one |
| PubChem CID | 89035499 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(CC)OCCC(CC)CC |
| InChI | InChI=1S/C15H28O2/c1-7-13(8-2)10-11-17-15(6,9-3)14(16)12(4)5/h13H,4,7-11H2,1-3,5-6H3 |
| InChIKey | MUKBQWZKKQQHCZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one?
The IUPAC name of 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one (CID 89035499) is 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one.
What is the SMILES notation for 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one?
The canonical SMILES for 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one is C=C(C)C(=O)C(C)(CC)OCCC(CC)CC.
What is the InChIKey of 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one?
The InChIKey is MUKBQWZKKQQHCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-7-13(8-2)10-11-17-15(6,9-3)14(16)12(4)5/h13H,4,7-11H2,1-3,5-6H3.
What are the key properties of 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one?
4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one has a molecular weight of 240.39 g/mol, XLogP of 4.14, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethylpentoxy)-2,4-dimethylhex-1-en-3-one is sourced from PubChem (CID 89035499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).