About (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol
(2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol (PubChem CID 89035680) has the molecular formula C15H31FO2
and a molecular weight of 262.41 g/mol. Its IUPAC name is (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol |
| PubChem CID | 89035680 |
| Molecular Formula | C15H31FO2 |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol |
| SMILES | CCCC(CC)OC(C)(C)CC(C)(C)[C@H](O)CF |
| InChI | InChI=1S/C15H31FO2/c1-7-9-12(8-2)18-15(5,6)11-14(3,4)13(17)10-16/h12-13,17H,7-11H2,1-6H3/t12?,13-/m1/s1 |
| InChIKey | PBZPNSIBLQDNRY-ZGTCLIOFSA-N |
| XLogP | 4.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol?
The IUPAC name of (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol (CID 89035680) is (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol.
What is the SMILES notation for (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol?
The canonical SMILES for (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol is CCCC(CC)OC(C)(C)CC(C)(C)[C@H](O)CF.
What is the InChIKey of (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol?
The InChIKey is PBZPNSIBLQDNRY-ZGTCLIOFSA-N. The full InChI is InChI=1S/C15H31FO2/c1-7-9-12(8-2)18-15(5,6)11-14(3,4)13(17)10-16/h12-13,17H,7-11H2,1-6H3/t12?,13-/m1/s1.
What are the key properties of (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol?
(2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol has a molecular weight of 262.41 g/mol, XLogP of 4.11, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-fluoro-5-hexan-3-yloxy-3,3,5-trimethylhexan-2-ol is sourced from PubChem (CID 89035680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).