C18H30O5 — CID 89035779
(3aR,6aR)-4-(1-ethoxycyclohexyl)oxyspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 89035779) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is (3aR,6aR)-4-(1-ethoxycyclohexyl)oxyspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aR,6aR)-4-(1-ethoxycyclohexyl)oxyspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 89035779 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (3aR,6aR)-4-(1-ethoxycyclohexyl)oxyspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | CCOC1(OC2OC[C@H]3OC4(CCCCC4)O[C@@H]23)CCCCC1 |
| InChI | InChI=1S/C18H30O5/c1-2-20-17(9-5-3-6-10-17)23-16-15-14(13-19-16)21-18(22-15)11-7-4-8-12-18/h14-16H,2-13H2,1H3/t14-,15-,16?/m1/s1 |
| InChIKey | CNVLCWIPPVVFQB-YGFGXBMJSA-N |
| XLogP | 3.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|