About trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine
trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine (PubChem CID 89035848) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine.
Molecular Properties
| Compound Name | trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine |
| PubChem CID | 89035848 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine |
| SMILES | CN[C@@H]1CCC[C@H]1N |
| InChI | InChI=1S/C6H14N2/c1-8-6-4-2-3-5(6)7/h5-6,8H,2-4,7H2,1H3/t5-,6-/m1/s1 |
| InChIKey | NVCOVOPUIYCNSW-PHDIDXHHSA-N |
| XLogP | 0.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine?
The IUPAC name of trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine (CID 89035848) is trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine.
What is the SMILES notation for trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine?
The canonical SMILES for trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine is CN[C@@H]1CCC[C@H]1N.
What is the InChIKey of trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine?
The InChIKey is NVCOVOPUIYCNSW-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H14N2/c1-8-6-4-2-3-5(6)7/h5-6,8H,2-4,7H2,1H3/t5-,6-/m1/s1.
What are the key properties of trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine?
trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine has a molecular weight of 114.19 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-N-methylcyclopentane-1,2-diamine is sourced from PubChem (CID 89035848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).