C9H7N3O — CID 89036077
8-oxa-3,6,11-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaene (PubChem CID 89036077) has the molecular formula C9H7N3O and a molecular weight of 173.18 g/mol. Its IUPAC name is 8-oxa-3,6,11-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaene.
| Compound Name | 8-oxa-3,6,11-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaene |
|---|---|
| PubChem CID | 89036077 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 8-oxa-3,6,11-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaene |
| SMILES | c1cc2c(cn1)OCn1ccnc1-2 |
| InChI | InChI=1S/C9H7N3O/c1-2-10-5-8-7(1)9-11-3-4-12(9)6-13-8/h1-5H,6H2 |
| InChIKey | DOLPBZBGPKPHRT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |