C40H24N2 — CID 89036096
4-[6-(4-cyanophenyl)-9,10-diphenylanthracen-2-yl]benzonitrile (PubChem CID 89036096) has the molecular formula C40H24N2 and a molecular weight of 532.65 g/mol. Its IUPAC name is 4-[6-(4-cyanophenyl)-9,10-diphenylanthracen-2-yl]benzonitrile.
| Compound Name | 4-[6-(4-cyanophenyl)-9,10-diphenylanthracen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 89036096 |
| Molecular Formula | C40H24N2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-[6-(4-cyanophenyl)-9,10-diphenylanthracen-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(-c4ccccc4)c4cc(-c5ccc(C#N)cc5)ccc4c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C40H24N2/c41-25-27-11-15-29(16-12-27)33-20-22-36-37(23-33)39(31-7-3-1-4-8-31)35-21-19-34(30-17-13-28(26-42)14-18-30)24-38(35)40(36)32-9-5-2-6-10-32/h1-24H |
| InChIKey | UQEBJOLRQORVRJ-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|