About 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide
1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide (PubChem CID 89036138) has the molecular formula C16H24ClNO4S
and a molecular weight of 361.89 g/mol. Its IUPAC name is 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide |
| PubChem CID | 89036138 |
| Molecular Formula | C16H24ClNO4S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide |
| SMILES | CC(C)c1ccc(OC[C@H]2COCC[C@H]2NS(=O)(=O)CCl)cc1 |
| InChI | InChI=1S/C16H24ClNO4S/c1-12(2)13-3-5-15(6-4-13)22-10-14-9-21-8-7-16(14)18-23(19,20)11-17/h3-6,12,14,16,18H,7-11H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | KGVQWOCTOWWBIQ-GDBMZVCRSA-N |
| XLogP | 2.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide?
The IUPAC name of 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide (CID 89036138) is 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide.
What is the SMILES notation for 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide?
The canonical SMILES for 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide is CC(C)c1ccc(OC[C@H]2COCC[C@H]2NS(=O)(=O)CCl)cc1.
What is the InChIKey of 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide?
The InChIKey is KGVQWOCTOWWBIQ-GDBMZVCRSA-N. The full InChI is InChI=1S/C16H24ClNO4S/c1-12(2)13-3-5-15(6-4-13)22-10-14-9-21-8-7-16(14)18-23(19,20)11-17/h3-6,12,14,16,18H,7-11H2,1-2H3/t14-,16-/m1/s1.
What are the key properties of 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide?
1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide has a molecular weight of 361.89 g/mol, XLogP of 2.71, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N-[(3R,4R)-3-[(4-propan-2-ylphenoxy)methyl]oxan-4-yl]methanesulfonamide is sourced from PubChem (CID 89036138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).