C17H27ClN4O3S — CID 89036173
4-N-[(3aR,4S,6R,6aS)-4-ethoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-2-propylsulfanylpyrimidine-4,5-diamine (PubChem CID 89036173) has the molecular formula C17H27ClN4O3S and a molecular weight of 402.95 g/mol. Its IUPAC name is 4-N-[(3aR,4S,6R,6aS)-4-ethoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-2-propylsulfanylpyrimidine-4,5-diamine.
| Compound Name | 4-N-[(3aR,4S,6R,6aS)-4-ethoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-2-propylsulfanylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 89036173 |
| Molecular Formula | C17H27ClN4O3S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-N-[(3aR,4S,6R,6aS)-4-ethoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-2-propylsulfanylpyrimidine-4,5-diamine |
| SMILES | CCCSc1nc(Cl)c(N)c(N[C@@H]2C[C@H](OCC)[C@H]3OC(C)(C)O[C@H]32)n1 |
| InChI | InChI=1S/C17H27ClN4O3S/c1-5-7-26-16-21-14(18)11(19)15(22-16)20-9-8-10(23-6-2)13-12(9)24-17(3,4)25-13/h9-10,12-13H,5-8,19H2,1-4H3,(H,20,21,22)/t9-,10+,12+,13-/m1/s1 |
| InChIKey | QBFHTDKGXCSTKD-RSLMWUCJSA-N |
| XLogP | 3.32 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |