C35H37F5N2O3 — CID 89036245
1-benzyl-3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]urea (PubChem CID 89036245) has the molecular formula C35H37F5N2O3 and a molecular weight of 628.68 g/mol. Its IUPAC name is 1-benzyl-3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 89036245 |
| Molecular Formula | C35H37F5N2O3 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | 1-benzyl-3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]urea |
| SMILES | C[C@]12C[C@H](c3ccc(CNC(=O)NCc4ccccc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H37F5N2O3/c1-32-18-28(23-9-7-22(8-10-23)20-42-31(44)41-19-21-5-3-2-4-6-21)30-26-14-12-25(43)17-24(26)11-13-27(30)29(32)15-16-33(32,45)34(36,37)35(38,39)40/h2-10,17,27-29,45H,11-16,18-20H2,1H3,(H2,41,42,44)/t27?,28-,29?,32+,33+/m1/s1 |
| InChIKey | GSEADRZERRDVFK-CUIGNWKOSA-N |
| XLogP | 7.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|