C31H35F5N2O5 — CID 89036252
3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylcarbamoylamino]propanoic acid (PubChem CID 89036252) has the molecular formula C31H35F5N2O5 and a molecular weight of 610.62 g/mol. Its IUPAC name is 3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylcarbamoylamino]propanoic acid.
| Compound Name | 3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 89036252 |
| Molecular Formula | C31H35F5N2O5 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | 3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylcarbamoylamino]propanoic acid |
| SMILES | C[C@]12C[C@H](c3ccc(CNC(=O)NCCC(=O)O)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H35F5N2O5/c1-28-15-23(18-4-2-17(3-5-18)16-38-27(42)37-13-11-25(40)41)26-21-9-7-20(39)14-19(21)6-8-22(26)24(28)10-12-29(28,43)30(32,33)31(34,35)36/h2-5,14,22-24,43H,6-13,15-16H2,1H3,(H,40,41)(H2,37,38,42)/t22?,23-,24?,28+,29+/m1/s1 |
| InChIKey | CEZMOAYMZVSHTE-XLJKZNDPSA-N |
| XLogP | 5.79 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|