C19H27ClN4O7S — CID 89036301
ethyl 2-[[(3aR,4S,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetate (PubChem CID 89036301) has the molecular formula C19H27ClN4O7S and a molecular weight of 490.97 g/mol. Its IUPAC name is ethyl 2-[[(3aR,4S,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(3aR,4S,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetate |
|---|---|
| PubChem CID | 89036301 |
| Molecular Formula | C19H27ClN4O7S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | ethyl 2-[[(3aR,4S,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetate |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(NC2C[C@H](OCC(=O)OCC)[C@H]3OC(C)(C)O[C@@H]23)n1 |
| InChI | InChI=1S/C19H27ClN4O7S/c1-5-7-32-18-22-16(20)13(24(26)27)17(23-18)21-10-8-11(29-9-12(25)28-6-2)15-14(10)30-19(3,4)31-15/h10-11,14-15H,5-9H2,1-4H3,(H,21,22,23)/t10?,11-,14-,15+/m0/s1 |
| InChIKey | RPJIECYPGKCECM-FCXHOERTSA-N |
| XLogP | 3.19 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|