C34H35F5N2O3 — CID 89036396
1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]-3-phenylurea (PubChem CID 89036396) has the molecular formula C34H35F5N2O3 and a molecular weight of 614.66 g/mol. Its IUPAC name is 1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]-3-phenylurea.
| Compound Name | 1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 89036396 |
| Molecular Formula | C34H35F5N2O3 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]-3-phenylurea |
| SMILES | C[C@]12C[C@H](c3ccc(CNC(=O)Nc4ccccc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H35F5N2O3/c1-31-18-27(21-9-7-20(8-10-21)19-40-30(43)41-23-5-3-2-4-6-23)29-25-14-12-24(42)17-22(25)11-13-26(29)28(31)15-16-32(31,44)33(35,36)34(37,38)39/h2-10,17,26-28,44H,11-16,18-19H2,1H3,(H2,40,41,43)/t26?,27-,28?,31+,32+/m1/s1 |
| InChIKey | FWRBZDKEFIVKPO-FMWKCXSCSA-N |
| XLogP | 7.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|