About 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline
10-methyl-9,10-dihydropyrido[2,3-h]quinazoline (PubChem CID 89036409) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline.
Molecular Properties
| Compound Name | 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline |
| PubChem CID | 89036409 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline |
| SMILES | CC1CC=Nc2ccc3cncnc3c21 |
| InChI | InChI=1S/C12H11N3/c1-8-4-5-14-10-3-2-9-6-13-7-15-12(9)11(8)10/h2-3,5-8H,4H2,1H3 |
| InChIKey | QBHMWBIUTXDNMV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline?
The IUPAC name of 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline (CID 89036409) is 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline.
What is the SMILES notation for 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline?
The canonical SMILES for 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline is CC1CC=Nc2ccc3cncnc3c21.
What is the InChIKey of 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline?
The InChIKey is QBHMWBIUTXDNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-8-4-5-14-10-3-2-9-6-13-7-15-12(9)11(8)10/h2-3,5-8H,4H2,1H3.
What are the key properties of 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline?
10-methyl-9,10-dihydropyrido[2,3-h]quinazoline has a molecular weight of 197.24 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-9,10-dihydropyrido[2,3-h]quinazoline is sourced from PubChem (CID 89036409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).