C16H15ClFN5O4S2 — CID 89036544
5-[(4aR)-3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 89036544) has the molecular formula C16H15ClFN5O4S2 and a molecular weight of 459.91 g/mol. Its IUPAC name is 5-[(4aR)-3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 5-[(4aR)-3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 89036544 |
| Molecular Formula | C16H15ClFN5O4S2 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | 5-[(4aR)-3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | CN1C(N)=N[C@@]2(c3sc(C(=O)Nc4cccc(F)n4)cc3Cl)CCOC2S1(=O)=O |
| InChI | InChI=1S/C16H15ClFN5O4S2/c1-23-15(19)22-16(5-6-27-14(16)29(23,25)26)12-8(17)7-9(28-12)13(24)21-11-4-2-3-10(18)20-11/h2-4,7,14H,5-6H2,1H3,(H2,19,22)(H,20,21,24)/t14?,16-/m1/s1 |
| InChIKey | ZXOZNLORPGWYRS-BZSJEYESSA-N |
| XLogP | 1.72 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|