About 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine
4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine (PubChem CID 89037011) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine |
| PubChem CID | 89037011 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine |
| SMILES | CC1=CC(C[C@H]2CCNC2)=NC(N)C1 |
| InChI | InChI=1S/C11H19N3/c1-8-4-10(14-11(12)5-8)6-9-2-3-13-7-9/h4,9,11,13H,2-3,5-7,12H2,1H3/t9-,11?/m1/s1 |
| InChIKey | CFKBYASUHLKDJK-BFHBGLAWSA-N |
| XLogP | 1.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine?
The IUPAC name of 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine (CID 89037011) is 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine.
What is the SMILES notation for 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine?
The canonical SMILES for 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine is CC1=CC(C[C@H]2CCNC2)=NC(N)C1.
What is the InChIKey of 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine?
The InChIKey is CFKBYASUHLKDJK-BFHBGLAWSA-N. The full InChI is InChI=1S/C11H19N3/c1-8-4-10(14-11(12)5-8)6-9-2-3-13-7-9/h4,9,11,13H,2-3,5-7,12H2,1H3/t9-,11?/m1/s1.
What are the key properties of 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine?
4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine has a molecular weight of 193.29 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-[[(3R)-pyrrolidin-3-yl]methyl]-2,3-dihydropyridin-2-amine is sourced from PubChem (CID 89037011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).