C11H15F6N3O4 — CID 89037047
3-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]propanoic acid (PubChem CID 89037047) has the molecular formula C11H15F6N3O4 and a molecular weight of 367.25 g/mol. Its IUPAC name is 3-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]propanoic acid.
| Compound Name | 3-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 89037047 |
| Molecular Formula | C11H15F6N3O4 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(CCNC(=O)C(F)(F)F)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F6N3O4/c12-10(13,14)8(23)18-2-5-20(4-1-7(21)22)6-3-19-9(24)11(15,16)17/h1-6H2,(H,18,23)(H,19,24)(H,21,22) |
| InChIKey | XNBYXVQEYDYFOX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |