C7H11N3O2 — CID 89037224
3-ethyl-1,5-dimethyl-4-nitropyrazole (PubChem CID 89037224) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 3-ethyl-1,5-dimethyl-4-nitropyrazole.
| Compound Name | 3-ethyl-1,5-dimethyl-4-nitropyrazole |
|---|---|
| PubChem CID | 89037224 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 3-ethyl-1,5-dimethyl-4-nitropyrazole |
| SMILES | CCc1nn(C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N3O2/c1-4-6-7(10(11)12)5(2)9(3)8-6/h4H2,1-3H3 |
| InChIKey | XEIAKVVXHXTOBK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|