C18H22F2N6O3S — CID 89037243
(9S)-7-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-9-(2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,8,9-tetrahydro-1,2,4,7-thiatriazonin-3-amine (PubChem CID 89037243) has the molecular formula C18H22F2N6O3S and a molecular weight of 440.48 g/mol. Its IUPAC name is (9S)-7-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-9-(2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,8,9-tetrahydro-1,2,4,7-thiatriazonin-3-amine.
| Compound Name | (9S)-7-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-9-(2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,8,9-tetrahydro-1,2,4,7-thiatriazonin-3-amine |
|---|---|
| PubChem CID | 89037243 |
| Molecular Formula | C18H22F2N6O3S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (9S)-7-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-9-(2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,8,9-tetrahydro-1,2,4,7-thiatriazonin-3-amine |
| SMILES | COc1nc(N2CC/N=C(/N)N(C)S(=O)(=O)[C@@H](c3ccccc3F)C2)nc(C)c1F |
| InChI | InChI=1S/C18H22F2N6O3S/c1-11-15(20)16(29-3)24-18(23-11)26-9-8-22-17(21)25(2)30(27,28)14(10-26)12-6-4-5-7-13(12)19/h4-7,14H,8-10H2,1-3H3,(H2,21,22)/t14-/m1/s1 |
| InChIKey | QTUAICPGEQAJOA-CQSZACIVSA-N |
| XLogP | 1.21 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |