About O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine
O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine (PubChem CID 89037289) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine.
Molecular Properties
| Compound Name | O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine |
| PubChem CID | 89037289 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine |
| SMILES | C=CC1=C(ON)CCOC1 |
| InChI | InChI=1S/C7H11NO2/c1-2-6-5-9-4-3-7(6)10-8/h2H,1,3-5,8H2 |
| InChIKey | OGHVYAWPGHITLV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine?
The IUPAC name of O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine (CID 89037289) is O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine.
What is the SMILES notation for O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine?
The canonical SMILES for O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine is C=CC1=C(ON)CCOC1.
What is the InChIKey of O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine?
The InChIKey is OGHVYAWPGHITLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-6-5-9-4-3-7(6)10-8/h2H,1,3-5,8H2.
What are the key properties of O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine?
O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine has a molecular weight of 141.17 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(5-ethenyl-3,6-dihydro-2H-pyran-4-yl)hydroxylamine is sourced from PubChem (CID 89037289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).