About 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene
5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene (PubChem CID 89037412) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene |
| PubChem CID | 89037412 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene |
| SMILES | CCOC[C@@H](OC)OC1C=CC(OC)=CC1 |
| InChI | InChI=1S/C12H20O4/c1-4-15-9-12(14-3)16-11-7-5-10(13-2)6-8-11/h5-7,11-12H,4,8-9H2,1-3H3/t11?,12-/m0/s1 |
| InChIKey | RSYKXYLKMZGBDR-KIYNQFGBSA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene?
The IUPAC name of 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene (CID 89037412) is 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene.
What is the SMILES notation for 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene?
The canonical SMILES for 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene is CCOC[C@@H](OC)OC1C=CC(OC)=CC1.
What is the InChIKey of 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene?
The InChIKey is RSYKXYLKMZGBDR-KIYNQFGBSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-15-9-12(14-3)16-11-7-5-10(13-2)6-8-11/h5-7,11-12H,4,8-9H2,1-3H3/t11?,12-/m0/s1.
What are the key properties of 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene?
5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene has a molecular weight of 228.29 g/mol, XLogP of 1.87, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S)-2-ethoxy-1-methoxyethoxy]-2-methoxycyclohexa-1,3-diene is sourced from PubChem (CID 89037412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).